C15H22INO4S — CID 72962931
2-methylpropyl 4-iodo-3-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 72962931) has the molecular formula C15H22INO4S and a molecular weight of 439.32 g/mol. Its IUPAC name is 2-methylpropyl 4-iodo-3-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | 2-methylpropyl 4-iodo-3-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 72962931 |
| Molecular Formula | C15H22INO4S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 2-methylpropyl 4-iodo-3-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(CI)CC(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C15H22INO4S/c1-11(2)10-21-15(18)8-13(9-16)17-22(19,20)14-6-4-12(3)5-7-14/h4-7,11,13,17H,8-10H2,1-3H3 |
| InChIKey | RWJDHJXWZJJXNF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|