C13H14O5-2 — CID 7037635
(2R)-2-(4-propoxyphenyl)butanedioate (PubChem CID 7037635) has the molecular formula C13H14O5-2 and a molecular weight of 250.25 g/mol. Its IUPAC name is (2R)-2-(4-propoxyphenyl)butanedioate.
| Compound Name | (2R)-2-(4-propoxyphenyl)butanedioate |
|---|---|
| PubChem CID | 7037635 |
| Molecular Formula | C13H14O5-2 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (2R)-2-(4-propoxyphenyl)butanedioate |
| SMILES | CCCOc1ccc([C@@H](CC(=O)[O-])C(=O)[O-])cc1 |
| InChI | InChI=1S/C13H16O5/c1-2-7-18-10-5-3-9(4-6-10)11(13(16)17)8-12(14)15/h3-6,11H,2,7-8H2,1H3,(H,14,15)(H,16,17)/p-2/t11-/m1/s1 |
| InChIKey | XLGBUOUEMBRMFC-LLVKDONJSA-L |
| XLogP | -0.55 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |