C24H22O10-4 — CID 7563904
(2R)-2-[4-[4-[4-[(1S)-1,2-dicarboxylatoethyl]phenoxy]butoxy]phenyl]butanedioate (PubChem CID 7563904) has the molecular formula C24H22O10-4 and a molecular weight of 470.43 g/mol. Its IUPAC name is (2R)-2-[4-[4-[4-[(1S)-1,2-dicarboxylatoethyl]phenoxy]butoxy]phenyl]butanedioate.
| Compound Name | (2R)-2-[4-[4-[4-[(1S)-1,2-dicarboxylatoethyl]phenoxy]butoxy]phenyl]butanedioate |
|---|---|
| PubChem CID | 7563904 |
| Molecular Formula | C24H22O10-4 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (2R)-2-[4-[4-[4-[(1S)-1,2-dicarboxylatoethyl]phenoxy]butoxy]phenyl]butanedioate |
| SMILES | O=C([O-])C[C@H](C(=O)[O-])c1ccc(OCCCCOc2ccc([C@@H](CC(=O)[O-])C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H26O10/c25-21(26)13-19(23(29)30)15-3-7-17(8-4-15)33-11-1-2-12-34-18-9-5-16(6-10-18)20(24(31)32)14-22(27)28/h3-10,19-20H,1-2,11-14H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32)/p-4/t19-,20+ |
| InChIKey | BECUWYXLSJSOBH-BGYRXZFFSA-J |
| XLogP | -2.13 |
| TPSA | 178.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|