C13H14ClN3O4S — CID 167984054
(3S)-3-[(5-chloro-1-methylimidazol-2-yl)sulfonylamino]-3-phenylpropanoic acid (PubChem CID 167984054) has the molecular formula C13H14ClN3O4S and a molecular weight of 343.79 g/mol. Its IUPAC name is (3S)-3-[(5-chloro-1-methylimidazol-2-yl)sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | (3S)-3-[(5-chloro-1-methylimidazol-2-yl)sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 167984054 |
| Molecular Formula | C13H14ClN3O4S |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | (3S)-3-[(5-chloro-1-methylimidazol-2-yl)sulfonylamino]-3-phenylpropanoic acid |
| SMILES | Cn1c(Cl)cnc1S(=O)(=O)N[C@@H](CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H14ClN3O4S/c1-17-11(14)8-15-13(17)22(20,21)16-10(7-12(18)19)9-5-3-2-4-6-9/h2-6,8,10,16H,7H2,1H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | NWZIZSOYLYNJHZ-JTQLQIEISA-N |
| XLogP | 1.57 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |