C26H25N5O6S2 — CID 70189319
3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-(naphthalen-1-ylsulfonylamino)propanoic acid (PubChem CID 70189319) has the molecular formula C26H25N5O6S2 and a molecular weight of 567.65 g/mol. Its IUPAC name is 3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-(naphthalen-1-ylsulfonylamino)propanoic acid.
| Compound Name | 3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-(naphthalen-1-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 70189319 |
| Molecular Formula | C26H25N5O6S2 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-(naphthalen-1-ylsulfonylamino)propanoic acid |
| SMILES | NC(N)=NN(c1cccc(C(CC(=O)O)NS(=O)(=O)c2cccc3ccccc23)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25N5O6S2/c27-26(28)29-31(39(36,37)21-12-2-1-3-13-21)20-11-6-10-19(16-20)23(17-25(32)33)30-38(34,35)24-15-7-9-18-8-4-5-14-22(18)24/h1-16,23,30H,17H2,(H,32,33)(H4,27,28,29) |
| InChIKey | MTYDINDQMAWTAW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|