C25H27N5O5S — CID 70016999
2-[[3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 70016999) has the molecular formula C25H27N5O5S and a molecular weight of 509.59 g/mol. Its IUPAC name is 2-[[3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | 2-[[3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70016999 |
| Molecular Formula | C25H27N5O5S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 2-[[3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)CC(c1ccccc1)c1cccc(N(N=C(N)N)S(=O)(=O)c2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C25H27N5O5S/c1-17(24(32)33)28-23(31)16-22(18-9-4-2-5-10-18)19-11-8-12-20(15-19)30(29-25(26)27)36(34,35)21-13-6-3-7-14-21/h2-15,17,22H,16H2,1H3,(H,28,31)(H,32,33)(H4,26,27,29) |
| InChIKey | NHRYHJIJFDFQHN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|