C22H21Cl2N5O6S2 — CID 70188218
3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-[(3,5-dichlorophenyl)sulfonylamino]propanoic acid (PubChem CID 70188218) has the molecular formula C22H21Cl2N5O6S2 and a molecular weight of 586.48 g/mol. Its IUPAC name is 3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-[(3,5-dichlorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-[(3,5-dichlorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 70188218 |
| Molecular Formula | C22H21Cl2N5O6S2 |
| Molecular Weight | 586.48 g/mol |
| Exact Mass | 585.03 |
| IUPAC Name | 3-[3-[benzenesulfonyl-(diaminomethylideneamino)amino]phenyl]-3-[(3,5-dichlorophenyl)sulfonylamino]propanoic acid |
| SMILES | NC(N)=NN(c1cccc(C(CC(=O)O)NS(=O)(=O)c2cc(Cl)cc(Cl)c2)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H21Cl2N5O6S2/c23-15-10-16(24)12-19(11-15)36(32,33)28-20(13-21(30)31)14-5-4-6-17(9-14)29(27-22(25)26)37(34,35)18-7-2-1-3-8-18/h1-12,20,28H,13H2,(H,30,31)(H4,25,26,27) |
| InChIKey | JKNWNIVKMRJALQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|