C23H21Cl2N5O5S — CID 139834013
3-(3,5-dichlorophenyl)-3-[[3-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]sulfonylamino]propanoic acid (PubChem CID 139834013) has the molecular formula C23H21Cl2N5O5S and a molecular weight of 550.42 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-[[3-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]sulfonylamino]propanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-3-[[3-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 139834013 |
| Molecular Formula | C23H21Cl2N5O5S |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-[[3-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]sulfonylamino]propanoic acid |
| SMILES | NN/C=N/c1cccc(C(=O)Nc2cccc(S(=O)(=O)NC(CC(=O)O)c3cc(Cl)cc(Cl)c3)c2)c1 |
| InChI | InChI=1S/C23H21Cl2N5O5S/c24-16-7-15(8-17(25)10-16)21(12-22(31)32)30-36(34,35)20-6-2-5-19(11-20)29-23(33)14-3-1-4-18(9-14)27-13-28-26/h1-11,13,21,30H,12,26H2,(H,27,28)(H,29,33)(H,31,32) |
| InChIKey | PWDJCPTVTUGIAU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|