C23H21Cl2N5O5S — CID 20666964
3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-[(3,5-dichlorophenyl)sulfonylamino]propanoic acid (PubChem CID 20666964) has the molecular formula C23H21Cl2N5O5S and a molecular weight of 550.42 g/mol. Its IUPAC name is 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-[(3,5-dichlorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-[(3,5-dichlorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 20666964 |
| Molecular Formula | C23H21Cl2N5O5S |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-[(3,5-dichlorophenyl)sulfonylamino]propanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)Nc2ccc(CC(NS(=O)(=O)c3cc(Cl)cc(Cl)c3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H21Cl2N5O5S/c24-15-10-16(25)12-19(11-15)36(34,35)30-20(22(32)33)8-13-4-6-17(7-5-13)28-21(31)14-2-1-3-18(9-14)29-23(26)27/h1-7,9-12,20,30H,8H2,(H,28,31)(H,32,33)(H4,26,27,29) |
| InChIKey | GBPJPKARXPCBQC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|