C23H23N5O5S — CID 70071027
(2S)-2-[benzenesulfonyl-[[3-(hydrazinylmethylideneamino)benzoyl]amino]amino]-3-phenylpropanoic acid (PubChem CID 70071027) has the molecular formula C23H23N5O5S and a molecular weight of 481.53 g/mol. Its IUPAC name is (2S)-2-[benzenesulfonyl-[[3-(hydrazinylmethylideneamino)benzoyl]amino]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[benzenesulfonyl-[[3-(hydrazinylmethylideneamino)benzoyl]amino]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70071027 |
| Molecular Formula | C23H23N5O5S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (2S)-2-[benzenesulfonyl-[[3-(hydrazinylmethylideneamino)benzoyl]amino]amino]-3-phenylpropanoic acid |
| SMILES | NN/C=N/c1cccc(C(=O)NN([C@@H](Cc2ccccc2)C(=O)O)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H23N5O5S/c24-26-16-25-19-11-7-10-18(15-19)22(29)27-28(34(32,33)20-12-5-2-6-13-20)21(23(30)31)14-17-8-3-1-4-9-17/h1-13,15-16,21H,14,24H2,(H,25,26)(H,27,29)(H,30,31)/t21-/m0/s1 |
| InChIKey | BNALLLBKFVMXJA-NRFANRHFSA-N |
| XLogP | 1.84 |
| TPSA | 154.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|