C22H26F3N5O5S — CID 70071459
(2S)-2-[butylsulfonyl-[[2-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]amino]-3-phenylpropanoic acid (PubChem CID 70071459) has the molecular formula C22H26F3N5O5S and a molecular weight of 529.54 g/mol. Its IUPAC name is (2S)-2-[butylsulfonyl-[[2-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[butylsulfonyl-[[2-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70071459 |
| Molecular Formula | C22H26F3N5O5S |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | (2S)-2-[butylsulfonyl-[[2-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]amino]-3-phenylpropanoic acid |
| SMILES | CCCCS(=O)(=O)N(NC(=O)c1cc(C(F)(F)F)ccc1/N=C/NN)[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H26F3N5O5S/c1-2-3-11-36(34,35)30(19(21(32)33)12-15-7-5-4-6-8-15)29-20(31)17-13-16(22(23,24)25)9-10-18(17)27-14-28-26/h4-10,13-14,19H,2-3,11-12,26H2,1H3,(H,27,28)(H,29,31)(H,32,33)/t19-/m0/s1 |
| InChIKey | WDDQQTRZWGPOCS-IBGZPJMESA-N |
| XLogP | 2.60 |
| TPSA | 154.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|