C26H27ClF3NO3 — CID 142192675
2-[[(2E,4E)-5-chloro-2-ethylhepta-2,4-dienoyl]-[[3-(trifluoromethyl)phenyl]methyl]amino]-3-phenylpropanoic acid (PubChem CID 142192675) has the molecular formula C26H27ClF3NO3 and a molecular weight of 493.95 g/mol. Its IUPAC name is 2-[[(2E,4E)-5-chloro-2-ethylhepta-2,4-dienoyl]-[[3-(trifluoromethyl)phenyl]methyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[(2E,4E)-5-chloro-2-ethylhepta-2,4-dienoyl]-[[3-(trifluoromethyl)phenyl]methyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 142192675 |
| Molecular Formula | C26H27ClF3NO3 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-[[(2E,4E)-5-chloro-2-ethylhepta-2,4-dienoyl]-[[3-(trifluoromethyl)phenyl]methyl]amino]-3-phenylpropanoic acid |
| SMILES | CC/C(Cl)=C\C=C(/CC)C(=O)N(Cc1cccc(C(F)(F)F)c1)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H27ClF3NO3/c1-3-20(13-14-22(27)4-2)24(32)31(17-19-11-8-12-21(15-19)26(28,29)30)23(25(33)34)16-18-9-6-5-7-10-18/h5-15,23H,3-4,16-17H2,1-2H3,(H,33,34)/b20-13+,22-14+ |
| InChIKey | LZTQCLYQNIICIX-STHOXOPSSA-N |
| XLogP | 6.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|