C27H24Cl2N2O3 — CID 90932649
2-[[5-chloro-2-(chloromethyl)hepta-2,4,6-trienoyl]-(quinolin-2-ylmethyl)amino]-3-phenylpropanoic acid (PubChem CID 90932649) has the molecular formula C27H24Cl2N2O3 and a molecular weight of 495.41 g/mol. Its IUPAC name is 2-[[5-chloro-2-(chloromethyl)hepta-2,4,6-trienoyl]-(quinolin-2-ylmethyl)amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[5-chloro-2-(chloromethyl)hepta-2,4,6-trienoyl]-(quinolin-2-ylmethyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 90932649 |
| Molecular Formula | C27H24Cl2N2O3 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 2-[[5-chloro-2-(chloromethyl)hepta-2,4,6-trienoyl]-(quinolin-2-ylmethyl)amino]-3-phenylpropanoic acid |
| SMILES | C=CC(Cl)=CC=C(CCl)C(=O)N(Cc1ccc2ccccc2n1)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H24Cl2N2O3/c1-2-22(29)14-12-21(17-28)26(32)31(25(27(33)34)16-19-8-4-3-5-9-19)18-23-15-13-20-10-6-7-11-24(20)30-23/h2-15,25H,1,16-18H2,(H,33,34) |
| InChIKey | IJXMKCKJDQGXBE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|