C23H28N6O4 — CID 70082758
2-[[[3-(diaminomethylideneamino)benzoyl]amino]-(piperidine-1-carbonyl)amino]-3-phenylpropanoic acid (PubChem CID 70082758) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is 2-[[[3-(diaminomethylideneamino)benzoyl]amino]-(piperidine-1-carbonyl)amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[[3-(diaminomethylideneamino)benzoyl]amino]-(piperidine-1-carbonyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70082758 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-[[[3-(diaminomethylideneamino)benzoyl]amino]-(piperidine-1-carbonyl)amino]-3-phenylpropanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)NN(C(=O)N2CCCCC2)C(Cc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C23H28N6O4/c24-22(25)26-18-11-7-10-17(15-18)20(30)27-29(23(33)28-12-5-2-6-13-28)19(21(31)32)14-16-8-3-1-4-9-16/h1,3-4,7-11,15,19H,2,5-6,12-14H2,(H,27,30)(H,31,32)(H4,24,25,26) |
| InChIKey | QPKUTESVHFQZHW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 154.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|