C18H16Cl2NO5- — CID 7300191
(3R)-3-[(3,4-dichlorobenzoyl)amino]-3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 7300191) has the molecular formula C18H16Cl2NO5- and a molecular weight of 397.23 g/mol. Its IUPAC name is (3R)-3-[(3,4-dichlorobenzoyl)amino]-3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | (3R)-3-[(3,4-dichlorobenzoyl)amino]-3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7300191 |
| Molecular Formula | C18H16Cl2NO5- |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | (3R)-3-[(3,4-dichlorobenzoyl)amino]-3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | COc1ccc([C@@H](CC(=O)[O-])NC(=O)c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H17Cl2NO5/c1-25-15-6-4-10(8-16(15)26-2)14(9-17(22)23)21-18(24)11-3-5-12(19)13(20)7-11/h3-8,14H,9H2,1-2H3,(H,21,24)(H,22,23)/p-1/t14-/m1/s1 |
| InChIKey | GQSFVVOQEBPUEG-CQSZACIVSA-M |
| XLogP | 2.62 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |