C19H24N2O4 — CID 42944232
4-[2-(ethylamino)-2-oxoethoxy]-N-[4-(furan-2-yl)butan-2-yl]benzamide (PubChem CID 42944232) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 4-[2-(ethylamino)-2-oxoethoxy]-N-[4-(furan-2-yl)butan-2-yl]benzamide.
| Compound Name | 4-[2-(ethylamino)-2-oxoethoxy]-N-[4-(furan-2-yl)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 42944232 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 4-[2-(ethylamino)-2-oxoethoxy]-N-[4-(furan-2-yl)butan-2-yl]benzamide |
| SMILES | CCNC(=O)COc1ccc(C(=O)NC(C)CCc2ccco2)cc1 |
| InChI | InChI=1S/C19H24N2O4/c1-3-20-18(22)13-25-17-10-7-15(8-11-17)19(23)21-14(2)6-9-16-5-4-12-24-16/h4-5,7-8,10-12,14H,3,6,9,13H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | XMEJZVANSKMVHJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |