C26H34N2O5S — CID 55687343
(E)-3-[4-(cyclopropylsulfamoyl)phenyl]-N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]prop-2-enamide (PubChem CID 55687343) has the molecular formula C26H34N2O5S and a molecular weight of 486.63 g/mol. Its IUPAC name is (E)-3-[4-(cyclopropylsulfamoyl)phenyl]-N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(cyclopropylsulfamoyl)phenyl]-N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]prop-2-enamide |
|---|---|
| PubChem CID | 55687343 |
| Molecular Formula | C26H34N2O5S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | (E)-3-[4-(cyclopropylsulfamoyl)phenyl]-N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]prop-2-enamide |
| SMILES | CCOc1ccc(C(NC(=O)/C=C/c2ccc(S(=O)(=O)NC3CC3)cc2)C(C)C)cc1OCC |
| InChI | InChI=1S/C26H34N2O5S/c1-5-32-23-15-10-20(17-24(23)33-6-2)26(18(3)4)27-25(29)16-9-19-7-13-22(14-8-19)34(30,31)28-21-11-12-21/h7-10,13-18,21,26,28H,5-6,11-12H2,1-4H3,(H,27,29)/b16-9+ |
| InChIKey | LYNFCVYSDLHPBW-CXUHLZMHSA-N |
| XLogP | 4.45 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|