C29H31ClN4O3S — CID 22918930
(E)-N-[4-[(1-benzylpiperidin-4-yl)sulfamoyl]phenyl]-3-(4-cyanophenyl)-N-methylprop-2-enamide;hydrochloride (PubChem CID 22918930) has the molecular formula C29H31ClN4O3S and a molecular weight of 551.11 g/mol. Its IUPAC name is (E)-N-[4-[(1-benzylpiperidin-4-yl)sulfamoyl]phenyl]-3-(4-cyanophenyl)-N-methylprop-2-enamide;hydrochloride.
| Compound Name | (E)-N-[4-[(1-benzylpiperidin-4-yl)sulfamoyl]phenyl]-3-(4-cyanophenyl)-N-methylprop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 22918930 |
| Molecular Formula | C29H31ClN4O3S |
| Molecular Weight | 551.11 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | (E)-N-[4-[(1-benzylpiperidin-4-yl)sulfamoyl]phenyl]-3-(4-cyanophenyl)-N-methylprop-2-enamide;hydrochloride |
| SMILES | CN(C(=O)/C=C/c1ccc(C#N)cc1)c1ccc(S(=O)(=O)NC2CCN(Cc3ccccc3)CC2)cc1.Cl |
| InChI | InChI=1S/C29H30N4O3S.ClH/c1-32(29(34)16-11-23-7-9-24(21-30)10-8-23)27-12-14-28(15-13-27)37(35,36)31-26-17-19-33(20-18-26)22-25-5-3-2-4-6-25;/h2-16,26,31H,17-20,22H2,1H3;1H/b16-11+; |
| InChIKey | XBZKOUNYTBTSDU-YFMOEUEHSA-N |
| XLogP | 4.60 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.11 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|