C20H22ClNO2S — CID 97019744
(3R)-N-[(5-chlorothiophen-2-yl)methyl]-3-cyclopropyl-3-hydroxy-3-phenyl-N-prop-2-enylpropanamide (PubChem CID 97019744) has the molecular formula C20H22ClNO2S and a molecular weight of 375.92 g/mol. Its IUPAC name is (3R)-N-[(5-chlorothiophen-2-yl)methyl]-3-cyclopropyl-3-hydroxy-3-phenyl-N-prop-2-enylpropanamide.
| Compound Name | (3R)-N-[(5-chlorothiophen-2-yl)methyl]-3-cyclopropyl-3-hydroxy-3-phenyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 97019744 |
| Molecular Formula | C20H22ClNO2S |
| Molecular Weight | 375.92 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (3R)-N-[(5-chlorothiophen-2-yl)methyl]-3-cyclopropyl-3-hydroxy-3-phenyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)C[C@](O)(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C20H22ClNO2S/c1-2-12-22(14-17-10-11-18(21)25-17)19(23)13-20(24,16-8-9-16)15-6-4-3-5-7-15/h2-7,10-11,16,24H,1,8-9,12-14H2/t20-/m0/s1 |
| InChIKey | ZEELQXUDOPHBNZ-FQEVSTJZSA-N |
| XLogP | 4.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.92 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|