C20H24ClN2O3S+ — CID 8689650
1-[(5-chloro-2-methoxyphenyl)methyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium (PubChem CID 8689650) has the molecular formula C20H24ClN2O3S+ and a molecular weight of 407.94 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxyphenyl)methyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium.
| Compound Name | 1-[(5-chloro-2-methoxyphenyl)methyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 8689650 |
| Molecular Formula | C20H24ClN2O3S+ |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 1-[(5-chloro-2-methoxyphenyl)methyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium |
| SMILES | COc1ccc(Cl)cc1C[NH+]1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23ClN2O3S/c1-26-20-8-7-19(21)15-18(20)16-22-10-12-23(13-11-22)27(24,25)14-9-17-5-3-2-4-6-17/h2-9,14-15H,10-13,16H2,1H3/p+1/b14-9+ |
| InChIKey | HRLMZAJNTCFCJT-NTEUORMPSA-O |
| XLogP | 2.05 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |