C18H18ClNO4 — CID 51870501
(4-chloro-2-methylphenyl) (3R)-1-(furan-3-carbonyl)piperidine-3-carboxylate (PubChem CID 51870501) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl) (3R)-1-(furan-3-carbonyl)piperidine-3-carboxylate.
| Compound Name | (4-chloro-2-methylphenyl) (3R)-1-(furan-3-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 51870501 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (4-chloro-2-methylphenyl) (3R)-1-(furan-3-carbonyl)piperidine-3-carboxylate |
| SMILES | Cc1cc(Cl)ccc1OC(=O)[C@@H]1CCCN(C(=O)c2ccoc2)C1 |
| InChI | InChI=1S/C18H18ClNO4/c1-12-9-15(19)4-5-16(12)24-18(22)13-3-2-7-20(10-13)17(21)14-6-8-23-11-14/h4-6,8-9,11,13H,2-3,7,10H2,1H3/t13-/m1/s1 |
| InChIKey | AAGSMQAPRAAYIX-CYBMUJFWSA-N |
| XLogP | 3.70 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|