C21H23Cl2N3O5 — CID 43056968
N'-[4-(2,4-dichlorophenoxy)butanoyl]-1-(furan-3-carbonyl)piperidine-3-carbohydrazide (PubChem CID 43056968) has the molecular formula C21H23Cl2N3O5 and a molecular weight of 468.34 g/mol. Its IUPAC name is N'-[4-(2,4-dichlorophenoxy)butanoyl]-1-(furan-3-carbonyl)piperidine-3-carbohydrazide.
| Compound Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-1-(furan-3-carbonyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 43056968 |
| Molecular Formula | C21H23Cl2N3O5 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-1-(furan-3-carbonyl)piperidine-3-carbohydrazide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)C1CCCN(C(=O)c2ccoc2)C1 |
| InChI | InChI=1S/C21H23Cl2N3O5/c22-16-5-6-18(17(23)11-16)31-9-2-4-19(27)24-25-20(28)14-3-1-8-26(12-14)21(29)15-7-10-30-13-15/h5-7,10-11,13-14H,1-4,8-9,12H2,(H,24,27)(H,25,28) |
| InChIKey | AWPYCCCWICRDAL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|