C17H15BrClNO4 — CID 43054836
(4-bromo-2-chlorophenyl) 1-(furan-3-carbonyl)piperidine-3-carboxylate (PubChem CID 43054836) has the molecular formula C17H15BrClNO4 and a molecular weight of 412.67 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl) 1-(furan-3-carbonyl)piperidine-3-carboxylate.
| Compound Name | (4-bromo-2-chlorophenyl) 1-(furan-3-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 43054836 |
| Molecular Formula | C17H15BrClNO4 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | (4-bromo-2-chlorophenyl) 1-(furan-3-carbonyl)piperidine-3-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cc1Cl)C1CCCN(C(=O)c2ccoc2)C1 |
| InChI | InChI=1S/C17H15BrClNO4/c18-13-3-4-15(14(19)8-13)24-17(22)11-2-1-6-20(9-11)16(21)12-5-7-23-10-12/h3-5,7-8,10-11H,1-2,6,9H2 |
| InChIKey | FSWUJUDSMONLLO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|