C17H15BrClNO3S — CID 55558967
(4-bromo-2-chlorophenyl) 1-(thiophene-2-carbonyl)piperidine-3-carboxylate (PubChem CID 55558967) has the molecular formula C17H15BrClNO3S and a molecular weight of 428.74 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl) 1-(thiophene-2-carbonyl)piperidine-3-carboxylate.
| Compound Name | (4-bromo-2-chlorophenyl) 1-(thiophene-2-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55558967 |
| Molecular Formula | C17H15BrClNO3S |
| Molecular Weight | 428.74 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | (4-bromo-2-chlorophenyl) 1-(thiophene-2-carbonyl)piperidine-3-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cc1Cl)C1CCCN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C17H15BrClNO3S/c18-12-5-6-14(13(19)9-12)23-17(22)11-3-1-7-20(10-11)16(21)15-4-2-8-24-15/h2,4-6,8-9,11H,1,3,7,10H2 |
| InChIKey | MHHLNKPZZRAFAZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.74 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|