C15H14ClNO3S — CID 74237771
[1-(5-chlorofuran-2-carbonyl)piperidin-3-yl]-thiophen-2-ylmethanone (PubChem CID 74237771) has the molecular formula C15H14ClNO3S and a molecular weight of 323.80 g/mol. Its IUPAC name is [1-(5-chlorofuran-2-carbonyl)piperidin-3-yl]-thiophen-2-ylmethanone.
| Compound Name | [1-(5-chlorofuran-2-carbonyl)piperidin-3-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 74237771 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | [1-(5-chlorofuran-2-carbonyl)piperidin-3-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)C1CCCN(C(=O)c2ccc(Cl)o2)C1 |
| InChI | InChI=1S/C15H14ClNO3S/c16-13-6-5-11(20-13)15(19)17-7-1-3-10(9-17)14(18)12-4-2-8-21-12/h2,4-6,8,10H,1,3,7,9H2 |
| InChIKey | HMLYMTCCBWWCAR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |