C14H17N3O4S — CID 175983862
1H-indazol-5-yl 1-methylsulfonylpiperidine-4-carboxylate (PubChem CID 175983862) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 1H-indazol-5-yl 1-methylsulfonylpiperidine-4-carboxylate.
| Compound Name | 1H-indazol-5-yl 1-methylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 175983862 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1H-indazol-5-yl 1-methylsulfonylpiperidine-4-carboxylate |
| SMILES | CS(=O)(=O)N1CCC(C(=O)Oc2ccc3[nH]ncc3c2)CC1 |
| InChI | InChI=1S/C14H17N3O4S/c1-22(19,20)17-6-4-10(5-7-17)14(18)21-12-2-3-13-11(8-12)9-15-16-13/h2-3,8-10H,4-7H2,1H3,(H,15,16) |
| InChIKey | AXHAPFMBKSETDR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|