C14H19N5O4S — CID 72916049
1-(1H-indazol-5-yl)-3-[(4-methylsulfonylmorpholin-2-yl)methyl]urea (PubChem CID 72916049) has the molecular formula C14H19N5O4S and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-(1H-indazol-5-yl)-3-[(4-methylsulfonylmorpholin-2-yl)methyl]urea.
| Compound Name | 1-(1H-indazol-5-yl)-3-[(4-methylsulfonylmorpholin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 72916049 |
| Molecular Formula | C14H19N5O4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-(1H-indazol-5-yl)-3-[(4-methylsulfonylmorpholin-2-yl)methyl]urea |
| SMILES | CS(=O)(=O)N1CCOC(CNC(=O)Nc2ccc3[nH]ncc3c2)C1 |
| InChI | InChI=1S/C14H19N5O4S/c1-24(21,22)19-4-5-23-12(9-19)8-15-14(20)17-11-2-3-13-10(6-11)7-16-18-13/h2-3,6-7,12H,4-5,8-9H2,1H3,(H,16,18)(H2,15,17,20) |
| InChIKey | ZLVDDPFILOEXHF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |