C11H20N6O4S — CID 125166321
1-(1-ethyltriazol-4-yl)-3-[[(2R)-4-methylsulfonylmorpholin-2-yl]methyl]urea (PubChem CID 125166321) has the molecular formula C11H20N6O4S and a molecular weight of 332.39 g/mol. Its IUPAC name is 1-(1-ethyltriazol-4-yl)-3-[[(2R)-4-methylsulfonylmorpholin-2-yl]methyl]urea.
| Compound Name | 1-(1-ethyltriazol-4-yl)-3-[[(2R)-4-methylsulfonylmorpholin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 125166321 |
| Molecular Formula | C11H20N6O4S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(1-ethyltriazol-4-yl)-3-[[(2R)-4-methylsulfonylmorpholin-2-yl]methyl]urea |
| SMILES | CCn1cc(NC(=O)NC[C@@H]2CN(S(C)(=O)=O)CCO2)nn1 |
| InChI | InChI=1S/C11H20N6O4S/c1-3-16-8-10(14-15-16)13-11(18)12-6-9-7-17(4-5-21-9)22(2,19)20/h8-9H,3-7H2,1-2H3,(H2,12,13,18)/t9-/m1/s1 |
| InChIKey | CEYVQGMXEFLNSC-SECBINFHSA-N |
| XLogP | -0.92 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |