C15H22N4O5S — CID 125161188
N-methyl-3-[[(2R)-4-methylsulfonylmorpholin-2-yl]methylcarbamoylamino]benzamide (PubChem CID 125161188) has the molecular formula C15H22N4O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-methyl-3-[[(2R)-4-methylsulfonylmorpholin-2-yl]methylcarbamoylamino]benzamide.
| Compound Name | N-methyl-3-[[(2R)-4-methylsulfonylmorpholin-2-yl]methylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 125161188 |
| Molecular Formula | C15H22N4O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-methyl-3-[[(2R)-4-methylsulfonylmorpholin-2-yl]methylcarbamoylamino]benzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)NC[C@@H]2CN(S(C)(=O)=O)CCO2)c1 |
| InChI | InChI=1S/C15H22N4O5S/c1-16-14(20)11-4-3-5-12(8-11)18-15(21)17-9-13-10-19(6-7-24-13)25(2,22)23/h3-5,8,13H,6-7,9-10H2,1-2H3,(H,16,20)(H2,17,18,21)/t13-/m1/s1 |
| InChIKey | CVYCGSHBHHKADR-CYBMUJFWSA-N |
| XLogP | -0.17 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |