C14H17N5O3 — CID 72869943
1-(1H-indazol-5-yl)-3-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]urea (PubChem CID 72869943) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 1-(1H-indazol-5-yl)-3-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]urea.
| Compound Name | 1-(1H-indazol-5-yl)-3-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 72869943 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1-(1H-indazol-5-yl)-3-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]urea |
| SMILES | O=C(NCCN1CCCOC1=O)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C14H17N5O3/c20-13(15-4-6-19-5-1-7-22-14(19)21)17-11-2-3-12-10(8-11)9-16-18-12/h2-3,8-9H,1,4-7H2,(H,16,18)(H2,15,17,20) |
| InChIKey | MFIALXLDCVSBOM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |