C20H23ClN2O5S — CID 29447944
(2S)-1-(benzenesulfonyl)-N-(5-chloro-2,4-dimethoxyphenyl)piperidine-2-carboxamide (PubChem CID 29447944) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is (2S)-1-(benzenesulfonyl)-N-(5-chloro-2,4-dimethoxyphenyl)piperidine-2-carboxamide.
| Compound Name | (2S)-1-(benzenesulfonyl)-N-(5-chloro-2,4-dimethoxyphenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 29447944 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (2S)-1-(benzenesulfonyl)-N-(5-chloro-2,4-dimethoxyphenyl)piperidine-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)[C@@H]2CCCCN2S(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H23ClN2O5S/c1-27-18-13-19(28-2)16(12-15(18)21)22-20(24)17-10-6-7-11-23(17)29(25,26)14-8-4-3-5-9-14/h3-5,8-9,12-13,17H,6-7,10-11H2,1-2H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | LVNBBIZPWNQNLQ-KRWDZBQOSA-N |
| XLogP | 3.54 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |