C27H34N2O4 — CID 74463175
ethyl 3-[4-[[1-(adamantane-1-carbonyl)pyrrolidine-2-carbonyl]amino]phenyl]prop-2-enoate (PubChem CID 74463175) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is ethyl 3-[4-[[1-(adamantane-1-carbonyl)pyrrolidine-2-carbonyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[[1-(adamantane-1-carbonyl)pyrrolidine-2-carbonyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 74463175 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | ethyl 3-[4-[[1-(adamantane-1-carbonyl)pyrrolidine-2-carbonyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(NC(=O)C2CCCN2C(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C27H34N2O4/c1-2-33-24(30)10-7-18-5-8-22(9-6-18)28-25(31)23-4-3-11-29(23)26(32)27-15-19-12-20(16-27)14-21(13-19)17-27/h5-10,19-21,23H,2-4,11-17H2,1H3,(H,28,31) |
| InChIKey | WQAULOIROCIWQI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|