C25H29N3O4 — CID 31508787
(2S)-1-(adamantane-1-carbonyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)pyrrolidine-2-carboxamide (PubChem CID 31508787) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is (2S)-1-(adamantane-1-carbonyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(adamantane-1-carbonyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 31508787 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (2S)-1-(adamantane-1-carbonyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)pyrrolidine-2-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)[C@@H]3CCCN3C(=O)C34CC5CC(CC(C5)C3)C4)cc2C1=O |
| InChI | InChI=1S/C25H29N3O4/c1-27-22(30)18-5-4-17(10-19(18)23(27)31)26-21(29)20-3-2-6-28(20)24(32)25-11-14-7-15(12-25)9-16(8-14)13-25/h4-5,10,14-16,20H,2-3,6-9,11-13H2,1H3,(H,26,29)/t14?,15?,16?,20-,25?/m0/s1 |
| InChIKey | VXGSJBLHTDXFJU-QPKOWOFHSA-N |
| XLogP | 3.06 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|