C25H34N4O2 — CID 51929068
(2R)-1-(adamantane-1-carbonyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)pyrrolidine-2-carboxamide (PubChem CID 51929068) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is (2R)-1-(adamantane-1-carbonyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(adamantane-1-carbonyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 51929068 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (2R)-1-(adamantane-1-carbonyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)nc1)[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H34N4O2/c30-23(27-20-5-6-22(26-16-20)28-7-1-2-8-28)21-4-3-9-29(21)24(31)25-13-17-10-18(14-25)12-19(11-17)15-25/h5-6,16-19,21H,1-4,7-15H2,(H,27,30)/t17?,18?,19?,21-,25?/m1/s1 |
| InChIKey | MPUJTWUCOBKXPT-YVXFQLMNSA-N |
| XLogP | 3.83 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |