C27H38N4O2 — CID 30933248
(2R)-1-(adamantane-1-carbonyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 30933248) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is (2R)-1-(adamantane-1-carbonyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(adamantane-1-carbonyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 30933248 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (2R)-1-(adamantane-1-carbonyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)[C@H]3CCCN3C(=O)C34CC5CC(CC(C5)C3)C4)cc2)CC1 |
| InChI | InChI=1S/C27H38N4O2/c1-29-9-11-30(12-10-29)23-6-4-22(5-7-23)28-25(32)24-3-2-8-31(24)26(33)27-16-19-13-20(17-27)15-21(14-19)18-27/h4-7,19-21,24H,2-3,8-18H2,1H3,(H,28,32)/t19?,20?,21?,24-,27?/m1/s1 |
| InChIKey | NOCYWZRSGRKAGR-AHRSHGDUSA-N |
| XLogP | 3.58 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|