C19H22N2O5 — CID 32528733
1-[4-(furan-3-carbonyl)piperazin-1-yl]-2-(2-methoxy-4-methylphenoxy)ethanone (PubChem CID 32528733) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 1-[4-(furan-3-carbonyl)piperazin-1-yl]-2-(2-methoxy-4-methylphenoxy)ethanone.
| Compound Name | 1-[4-(furan-3-carbonyl)piperazin-1-yl]-2-(2-methoxy-4-methylphenoxy)ethanone |
|---|---|
| PubChem CID | 32528733 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[4-(furan-3-carbonyl)piperazin-1-yl]-2-(2-methoxy-4-methylphenoxy)ethanone |
| SMILES | COc1cc(C)ccc1OCC(=O)N1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C19H22N2O5/c1-14-3-4-16(17(11-14)24-2)26-13-18(22)20-6-8-21(9-7-20)19(23)15-5-10-25-12-15/h3-5,10-12H,6-9,13H2,1-2H3 |
| InChIKey | RKIILVVASVLKMX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |