C21H24N2O6 — CID 108534571
2-(2,4-dimethylphenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]ethanone (PubChem CID 108534571) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2,4-dimethylphenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 108534571 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(OCC(=O)N2CCN(C(=O)c3cc(O)c(O)c(O)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H24N2O6/c1-13-3-4-18(14(2)9-13)29-12-19(26)22-5-7-23(8-6-22)21(28)15-10-16(24)20(27)17(25)11-15/h3-4,9-11,24-25,27H,5-8,12H2,1-2H3 |
| InChIKey | RRSVLPSBHBPSRF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|