C19H19ClN2O6 — CID 108534860
2-(4-chlorophenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]ethanone (PubChem CID 108534860) has the molecular formula C19H19ClN2O6 and a molecular weight of 406.82 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 108534860 |
| Molecular Formula | C19H19ClN2O6 |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1)N1CCN(C(=O)c2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C19H19ClN2O6/c20-13-1-3-14(4-2-13)28-11-17(25)21-5-7-22(8-6-21)19(27)12-9-15(23)18(26)16(24)10-12/h1-4,9-10,23-24,26H,5-8,11H2 |
| InChIKey | VDRWLUMYFCTKRS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|