C22H26N2O6 — CID 108534850
4-(4-methylphenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]butan-1-one (PubChem CID 108534850) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 4-(4-methylphenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-methylphenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108534850 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-(4-methylphenoxy)-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]butan-1-one |
| SMILES | Cc1ccc(OCCCC(=O)N2CCN(C(=O)c3cc(O)c(O)c(O)c3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O6/c1-15-4-6-17(7-5-15)30-12-2-3-20(27)23-8-10-24(11-9-23)22(29)16-13-18(25)21(28)19(26)14-16/h4-7,13-14,25-26,28H,2-3,8-12H2,1H3 |
| InChIKey | PBHPBLFWIBHVRW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|