C22H24N2O6 — CID 108534832
1-(4-methylphenyl)-4-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]butane-1,4-dione (PubChem CID 108534832) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]butane-1,4-dione.
| Compound Name | 1-(4-methylphenyl)-4-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 108534832 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-(4-methylphenyl)-4-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]butane-1,4-dione |
| SMILES | Cc1ccc(C(=O)CCC(=O)N2CCN(C(=O)c3cc(O)c(O)c(O)c3)CC2)cc1 |
| InChI | InChI=1S/C22H24N2O6/c1-14-2-4-15(5-3-14)17(25)6-7-20(28)23-8-10-24(11-9-23)22(30)16-12-18(26)21(29)19(27)13-16/h2-5,12-13,26-27,29H,6-11H2,1H3 |
| InChIKey | CXAQMLNMXIJKAA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|