C16H26Cl2N4O5 — CID 134144549
4,5-diamino-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]pentan-1-one;dihydrochloride (PubChem CID 134144549) has the molecular formula C16H26Cl2N4O5 and a molecular weight of 425.31 g/mol. Its IUPAC name is 4,5-diamino-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]pentan-1-one;dihydrochloride.
| Compound Name | 4,5-diamino-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]pentan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 134144549 |
| Molecular Formula | C16H26Cl2N4O5 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 4,5-diamino-1-[4-(3,4,5-trihydroxybenzoyl)piperazin-1-yl]pentan-1-one;dihydrochloride |
| SMILES | Cl.Cl.NCC(N)CCC(=O)N1CCN(C(=O)c2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C16H24N4O5.2ClH/c17-9-11(18)1-2-14(23)19-3-5-20(6-4-19)16(25)10-7-12(21)15(24)13(22)8-10;;/h7-8,11,21-22,24H,1-6,9,17-18H2;2*1H |
| InChIKey | NDHKNTROSTYVSC-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|