C22H25BrN2O3 — CID 108534152
1-[4-(2-bromobenzoyl)piperazin-1-yl]-4-(4-methylphenoxy)butan-1-one (PubChem CID 108534152) has the molecular formula C22H25BrN2O3 and a molecular weight of 445.36 g/mol. Its IUPAC name is 1-[4-(2-bromobenzoyl)piperazin-1-yl]-4-(4-methylphenoxy)butan-1-one.
| Compound Name | 1-[4-(2-bromobenzoyl)piperazin-1-yl]-4-(4-methylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 108534152 |
| Molecular Formula | C22H25BrN2O3 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1-[4-(2-bromobenzoyl)piperazin-1-yl]-4-(4-methylphenoxy)butan-1-one |
| SMILES | Cc1ccc(OCCCC(=O)N2CCN(C(=O)c3ccccc3Br)CC2)cc1 |
| InChI | InChI=1S/C22H25BrN2O3/c1-17-8-10-18(11-9-17)28-16-4-7-21(26)24-12-14-25(15-13-24)22(27)19-5-2-3-6-20(19)23/h2-3,5-6,8-11H,4,7,12-16H2,1H3 |
| InChIKey | IFCBATIYJZOFCE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|