C17H24FN3O2 — CID 16886603
N'-(2-fluorophenyl)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]oxamide (PubChem CID 16886603) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is N'-(2-fluorophenyl)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]oxamide.
| Compound Name | N'-(2-fluorophenyl)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 16886603 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N'-(2-fluorophenyl)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]oxamide |
| SMILES | CC(C)N1CCC(CNC(=O)C(=O)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C17H24FN3O2/c1-12(2)21-9-7-13(8-10-21)11-19-16(22)17(23)20-15-6-4-3-5-14(15)18/h3-6,12-13H,7-11H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | HRWQWOQOQYRRMD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|