C15H22N4O2 — CID 97364568
N-[(4aS,8R,8aS)-6-ethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyridazine-4-carboxamide (PubChem CID 97364568) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-ethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyridazine-4-carboxamide.
| Compound Name | N-[(4aS,8R,8aS)-6-ethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 97364568 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-ethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyridazine-4-carboxamide |
| SMILES | CCN1C[C@@H]2CCCO[C@@H]2[C@H](NC(=O)c2ccnnc2)C1 |
| InChI | InChI=1S/C15H22N4O2/c1-2-19-9-12-4-3-7-21-14(12)13(10-19)18-15(20)11-5-6-16-17-8-11/h5-6,8,12-14H,2-4,7,9-10H2,1H3,(H,18,20)/t12-,13+,14-/m0/s1 |
| InChIKey | QHDSMCOGLPWLJA-MJBXVCDLSA-N |
| XLogP | 0.71 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |