C14H21Cl2N3O2 — CID 155843708
N-[(4aS,8R,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-pyrano[3,2-c]pyridin-8-yl]pyridine-4-carboxamide;dihydrochloride (PubChem CID 155843708) has the molecular formula C14H21Cl2N3O2 and a molecular weight of 334.25 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-pyrano[3,2-c]pyridin-8-yl]pyridine-4-carboxamide;dihydrochloride.
| Compound Name | N-[(4aS,8R,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-pyrano[3,2-c]pyridin-8-yl]pyridine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 155843708 |
| Molecular Formula | C14H21Cl2N3O2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-[(4aS,8R,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-pyrano[3,2-c]pyridin-8-yl]pyridine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(N[C@@H]1CNC[C@@H]2CCCO[C@@H]21)c1ccncc1 |
| InChI | InChI=1S/C14H19N3O2.2ClH/c18-14(10-3-5-15-6-4-10)17-12-9-16-8-11-2-1-7-19-13(11)12;;/h3-6,11-13,16H,1-2,7-9H2,(H,17,18);2*1H/t11-,12+,13-;;/m0../s1 |
| InChIKey | TZWDKVXJWYJZHK-IQRIVPSGSA-N |
| XLogP | 1.42 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |