C13H19Cl2N3O2 — CID 127021534
N-[(3R,3aR,7aS)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrol-3-yl]pyridine-3-carboxamide;dihydrochloride (PubChem CID 127021534) has the molecular formula C13H19Cl2N3O2 and a molecular weight of 320.22 g/mol. Its IUPAC name is N-[(3R,3aR,7aS)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrol-3-yl]pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-[(3R,3aR,7aS)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrol-3-yl]pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 127021534 |
| Molecular Formula | C13H19Cl2N3O2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-[(3R,3aR,7aS)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrol-3-yl]pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(N[C@@H]1CN[C@H]2CCCO[C@H]21)c1cccnc1 |
| InChI | InChI=1S/C13H17N3O2.2ClH/c17-13(9-3-1-5-14-7-9)16-11-8-15-10-4-2-6-18-12(10)11;;/h1,3,5,7,10-12,15H,2,4,6,8H2,(H,16,17);2*1H/t10-,11+,12+;;/m0../s1 |
| InChIKey | STOPXQHOTBPKKC-MHIKFBLOSA-N |
| XLogP | 1.17 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |