C13H18N2O3 — CID 110125810
N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]pyridine-4-carboxamide (PubChem CID 110125810) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]pyridine-4-carboxamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 110125810 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]pyridine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H](O)[C@@H]1O)c1ccncc1 |
| InChI | InChI=1S/C13H18N2O3/c16-11-4-2-1-3-10(12(11)17)15-13(18)9-5-7-14-8-6-9/h5-8,10-12,16-17H,1-4H2,(H,15,18)/t10-,11-,12-/m1/s1 |
| InChIKey | VNQJFCSZKIBIOL-IJLUTSLNSA-N |
| XLogP | 0.48 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |