C11H15N3O2 — CID 104927784
N-[(1R,2R)-2-hydroxycyclohexyl]pyridazine-4-carboxamide (PubChem CID 104927784) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]pyridazine-4-carboxamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104927784 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]pyridazine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1ccnnc1 |
| InChI | InChI=1S/C11H15N3O2/c15-10-4-2-1-3-9(10)14-11(16)8-5-6-12-13-7-8/h5-7,9-10,15H,1-4H2,(H,14,16)/t9-,10-/m1/s1 |
| InChIKey | YPTPETFNOSJWFL-NXEZZACHSA-N |
| XLogP | 0.51 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |