C11H16N2O3S — CID 110125860
N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 110125860) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110125860 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H](O)[C@@H]1O)c1cncs1 |
| InChI | InChI=1S/C11H16N2O3S/c14-8-4-2-1-3-7(10(8)15)13-11(16)9-5-12-6-17-9/h5-8,10,14-15H,1-4H2,(H,13,16)/t7-,8-,10-/m1/s1 |
| InChIKey | ZOMGQTCFQGXPLJ-NQMVMOMDSA-N |
| XLogP | 0.54 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |