C13H20N2O2S — CID 126793620
N-[(1S,2S)-2-hydroxycyclohexyl]-2-propyl-1,3-thiazole-5-carboxamide (PubChem CID 126793620) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-2-propyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-propyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 126793620 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-propyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCc1ncc(C(=O)N[C@H]2CCCC[C@@H]2O)s1 |
| InChI | InChI=1S/C13H20N2O2S/c1-2-5-12-14-8-11(18-12)13(17)15-9-6-3-4-7-10(9)16/h8-10,16H,2-7H2,1H3,(H,15,17)/t9-,10-/m0/s1 |
| InChIKey | UXLHURZGQZWCCH-UWVGGRQHSA-N |
| XLogP | 2.13 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |